Products 215118-68-6
CAS 215118-68-6 appears in our catalog under these names: 4-(tert-Butylcarbamoyl)benzoic acid, 98%, 4-(tert-Butylcarbamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 5g, 2,5g.
4-(tert-butylcarbamoyl)benzoic acid (CAS 215118-68-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-(tert-butylcarbamoyl)benzoic acid. InChIKey: RRMLWCYLXRTPCH-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-(tert-butylcarbamoyl)benzoic acid |
| InChIKey | RRMLWCYLXRTPCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)