CAS 215239-69-3 is the registry number for 5-Bromo-2,7-dimethyl-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-2,4-dimethyl-1H-benzimidazole (CAS 215239-69-3) is a chemical compound with the molecular formula C9H9BrN2 and a molecular weight of 225.08 g/mol. IUPAC name: 6-bromo-2,4-dimethyl-1H-benzimidazole. InChIKey: GXRBMCDGVSZJHK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2 |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | 6-bromo-2,4-dimethyl-1H-benzimidazole |
| InChIKey | GXRBMCDGVSZJHK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(N2)C)Br |
Computed by PubChem (NCBI)