Products 2152663-87-9
CAS 2152663-87-9 is the registry number for 1-Hydroxy-7-isopropyl-1,3-dihydrobenzo[c][1,2]oxaborole-6-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg.
1-hydroxy-7-propan-2-yl-3H-2,1-benzoxaborole-6-carboxylic acid (CAS 2152663-87-9) is a chemical compound with the molecular formula C11H13BO4 and a molecular weight of 220.03 g/mol. IUPAC name: 1-hydroxy-7-propan-2-yl-3H-2,1-benzoxaborole-6-carboxylic acid. InChIKey: DNOBBKCYPACLPU-UHFFFAOYSA-N.
| Molecular formula | C11H13BO4 |
|---|---|
| Molecular weight | 220.03 g/mol |
| IUPAC name | 1-hydroxy-7-propan-2-yl-3H-2,1-benzoxaborole-6-carboxylic acid |
| InChIKey | DNOBBKCYPACLPU-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2C(C)C)C(=O)O)O |
Computed by PubChem (NCBI)