Products 21544-81-0
CAS 21544-81-0 appears in our catalog under these names: 4,6-Dimethoxy-1h-indole-2,3-dione, 95%, 4,6-Dimethoxyindoline-2,3-dione, 98%, 4,6-Dimethoxyindoline-2,3-dione, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg, 10g.
4,6-dimethoxy-1H-indole-2,3-dione (CAS 21544-81-0) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: 4,6-dimethoxy-1H-indole-2,3-dione. InChIKey: FAMGTYWNHVETJC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | 4,6-dimethoxy-1H-indole-2,3-dione |
| InChIKey | FAMGTYWNHVETJC-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)
Synonyms:
4,6-dimethoxy-2,3-dihydro-1H-indole-2,3-dione, 4,6-Dimethoxyindoline-2,3-dione, 4,6-dimethoxy-1H-indole-2,3-dione, 4,6-Dimethoxyisatin, 4,6-dimethoxy-2,3-dioxoindoline, 1H-Indole-2,3-dione, 4,6-dimethoxy-, 4,6-dimethoxyindo, 46-Dimethoxyindoline-23-dione, 4,6-dimethoxyindole-2,3-dione, FAMGTYWNHVETJC-UHFFFAOYSA-N