Products 2155852-10-9
CAS 2155852-10-9 is the registry number for 2-(Piperidin-3-yl)-1,3-thiazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-piperidin-3-yl-1,3-thiazole-4-carboxylic acid;hydrochloride (CAS 2155852-10-9) is a chemical compound with the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. IUPAC name: 2-piperidin-3-yl-1,3-thiazole-4-carboxylic acid;hydrochloride. InChIKey: BNMNLJDHMZBWBR-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2S |
|---|---|
| Molecular weight | 248.73 g/mol |
| IUPAC name | 2-piperidin-3-yl-1,3-thiazole-4-carboxylic acid;hydrochloride |
| InChIKey | BNMNLJDHMZBWBR-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC(=CS2)C(=O)O.Cl |
Computed by PubChem (NCBI)