CAS 2155855-29-9 appears in our catalog under these names: 1-(Aminomethyl)-3,3-difluorocyclobutane-1-carboxylic acid hydrochloride, 95%, 1-(Aminomethyl)-3,3-difluorocyclobutane-1-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(aminomethyl)-3,3-difluorocyclobutane-1-carboxylic acid;hydrochloride (CAS 2155855-29-9) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: 1-(aminomethyl)-3,3-difluorocyclobutane-1-carboxylic acid;hydrochloride. InChIKey: RWLXZUSFBYIGKE-UHFFFAOYSA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | 1-(aminomethyl)-3,3-difluorocyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | RWLXZUSFBYIGKE-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)(CN)C(=O)O.Cl |
Computed by PubChem (NCBI)