CAS 2567489-28-3 is the registry number for (R)-2-(4,4-Difluoropyrrolidin-2-yl)acetic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetic acid;hydrochloride (CAS 2567489-28-3) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetic acid;hydrochloride. InChIKey: RMFLOVWQPHFGET-PGMHMLKASA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | 2-[(2R)-4,4-difluoropyrrolidin-2-yl]acetic acid;hydrochloride |
| InChIKey | RMFLOVWQPHFGET-PGMHMLKASA-N |
| SMILES | C1[C@H](NCC1(F)F)CC(=O)O.Cl |
Computed by PubChem (NCBI)