CAS 2551076-38-9 is the registry number for (2S)-2-Amino-3-(2,2-difluorocyclopropyl)propanoic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(2S)-2-amino-3-(2,2-difluorocyclopropyl)propanoic acid;hydrochloride (CAS 2551076-38-9) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: (2S)-2-amino-3-(2,2-difluorocyclopropyl)propanoic acid;hydrochloride. InChIKey: YQKWVLWANBVXFE-LXNQBTANSA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,2-difluorocyclopropyl)propanoic acid;hydrochloride |
| InChIKey | YQKWVLWANBVXFE-LXNQBTANSA-N |
| SMILES | C1C(C1(F)F)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)