Products 2155855-81-3
CAS 2155855-81-3 is the registry number for 5H,6H,7H,8H-(1,2,4)Triazolo(1,5-a)pyridine-5-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid;hydrochloride (CAS 2155855-81-3) is a chemical compound with the molecular formula C7H10ClN3O2 and a molecular weight of 203.62 g/mol. IUPAC name: 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid;hydrochloride. InChIKey: XJNUYCAWKDREAX-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O2 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid;hydrochloride |
| InChIKey | XJNUYCAWKDREAX-UHFFFAOYSA-N |
| SMILES | C1CC(N2C(=NC=N2)C1)C(=O)O.Cl |
Computed by PubChem (NCBI)