CAS 215590-72-0 is the registry number for 4,4'-Methylene-d2-dianiline, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
4-[(4-aminophenyl)-dideuteriomethyl]aniline (CAS 215590-72-0) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 200.28 g/mol. IUPAC name: 4-[(4-aminophenyl)-dideuteriomethyl]aniline. InChIKey: YBRVSVVVWCFQMG-KNXIQCGSSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 4-[(4-aminophenyl)-dideuteriomethyl]aniline |
| InChIKey | YBRVSVVVWCFQMG-KNXIQCGSSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)N)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)