Products 215590-72-0

CAS 215590-72-0 is the registry number for 4,4'-Methylene-d2-dianiline, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

4-[(4-aminophenyl)-dideuteriomethyl]aniline (CAS 215590-72-0) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 200.28 g/mol. IUPAC name: 4-[(4-aminophenyl)-dideuteriomethyl]aniline. InChIKey: YBRVSVVVWCFQMG-KNXIQCGSSA-N.

Identity
Molecular formulaC13H14N2
Molecular weight200.28 g/mol
IUPAC name4-[(4-aminophenyl)-dideuteriomethyl]aniline
InChIKeyYBRVSVVVWCFQMG-KNXIQCGSSA-N
SMILES[2H]C([2H])(C1=CC=C(C=C1)N)C2=CC=C(C=C2)N

Computed by PubChem (NCBI)