CAS 215798-02-0 is the registry number for 6-(Trifluoromethoxy)-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-(trifluoromethoxy)-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 215798-02-0) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 6-(trifluoromethoxy)-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: LBWCHBSGCYRZMK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | LBWCHBSGCYRZMK-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)