CAS 215801-31-3 appears in our catalog under these names: (E)-3-(1H-Indol-6-yl)acrylic acid, 95%, (E)-3-(1H-Indol-6-yl)acrylic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg.
(E)-3-(1H-indol-6-yl)prop-2-enoic acid (CAS 215801-31-3) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: (E)-3-(1H-indol-6-yl)prop-2-enoic acid. InChIKey: ISFPWJSGXWEGPM-DUXPYHPUSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (E)-3-(1H-indol-6-yl)prop-2-enoic acid |
| InChIKey | ISFPWJSGXWEGPM-DUXPYHPUSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2)/C=C/C(=O)O |
Computed by PubChem (NCBI)