CAS 2158302-02-2 appears in our catalog under these names: Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate hydrochloride, 97%, Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate hydrochloride, 98%, (S)-benzyl 2-(cyanomethyl)piperazine-1-carboxylate hydrochloride, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 25g, 100mg, 1g, 250mg, 5g.
Benzyl (2S)-2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride (CAS 2158302-02-2) is a chemical compound with the molecular formula C14H18ClN3O2 and a molecular weight of 295.76 g/mol. IUPAC name: benzyl (2S)-2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride. InChIKey: ZGVOKAJRQLORSV-ZOWNYOTGSA-N.
| Molecular formula | C14H18ClN3O2 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | benzyl (2S)-2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | ZGVOKAJRQLORSV-ZOWNYOTGSA-N |
| SMILES | C1CN([C@H](CN1)CC#N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)