Products 2648586-02-9
CAS 2648586-02-9 is the registry number for Benzyl (R)-2-(Cyanomethyl)piperazine-1-carboxylate Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
Benzyl (2R)-2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride (CAS 2648586-02-9) is a chemical compound with the molecular formula C14H18ClN3O2 and a molecular weight of 295.76 g/mol. IUPAC name: benzyl (2R)-2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride. InChIKey: ZGVOKAJRQLORSV-BTQNPOSSSA-N.
| Molecular formula | C14H18ClN3O2 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | benzyl (2R)-2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | ZGVOKAJRQLORSV-BTQNPOSSSA-N |
| SMILES | C1CN([C@@H](CN1)CC#N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)