CAS 2161381-19-5 is the registry number for Regorafenib Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-fluoro-4-formamidophenoxy)-N-methylpyridine-2-carboxamide (CAS 2161381-19-5) is a chemical compound with the molecular formula C14H12FN3O3 and a molecular weight of 289.26 g/mol. IUPAC name: 4-(3-fluoro-4-formamidophenoxy)-N-methylpyridine-2-carboxamide. InChIKey: WUIDSEDQZCGQKY-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O3 |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | 4-(3-fluoro-4-formamidophenoxy)-N-methylpyridine-2-carboxamide |
| InChIKey | WUIDSEDQZCGQKY-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)NC=O)F |
Computed by PubChem (NCBI)