CAS 78755-82-5 appears in our catalog under these names: Flumazenil Impurity 5, Flumazenil Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (CAS 78755-82-5) is a chemical compound with the molecular formula C14H12FN3O3 and a molecular weight of 289.26 g/mol. IUPAC name: methyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate. InChIKey: JXEPEXMMOWPOCX-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O3 |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | methyl 8-fluoro-5-methyl-6-oxo-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| InChIKey | JXEPEXMMOWPOCX-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(N=CN2C3=C(C1=O)C=C(C=C3)F)C(=O)OC |
Computed by PubChem (NCBI)