CAS 894280-02-5 is the registry number for MAO-B-IN-37. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(4-fluorophenyl)methyl]-3-(4-nitrophenyl)urea (CAS 894280-02-5) is a chemical compound with the molecular formula C14H12FN3O3 and a molecular weight of 289.26 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]-3-(4-nitrophenyl)urea. InChIKey: CNCUTUBGEJMBFW-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O3 |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]-3-(4-nitrophenyl)urea |
| InChIKey | CNCUTUBGEJMBFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)NC2=CC=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)