CAS 79089-72-8 appears in our catalog under these names: Flumazenil Impurity 13, Flumazenil Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 8-fluoro-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (CAS 79089-72-8) is a chemical compound with the molecular formula C14H12FN3O3 and a molecular weight of 289.26 g/mol. IUPAC name: ethyl 8-fluoro-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carboxylate. InChIKey: VZVRAZNHBCFAMI-UHFFFAOYSA-N.
| Molecular formula | C14H12FN3O3 |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | ethyl 8-fluoro-6-oxo-4,5-dihydroimidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| InChIKey | VZVRAZNHBCFAMI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2CNC(=O)C3=C(N2C=N1)C=CC(=C3)F |
Computed by PubChem (NCBI)