Products 2349749-83-1
CAS 2349749-83-1 is the registry number for (R)-3-(1-Acetyl-4-piperidyl)-2-(Boc-amino)propanoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-3-(1-acetylpiperidin-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2349749-83-1) is a chemical compound with the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. IUPAC name: (2R)-3-(1-acetylpiperidin-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JOSJVRLACWWEMN-GFCCVEGCSA-N.
| Molecular formula | C15H26N2O5 |
|---|---|
| Molecular weight | 314.38 g/mol |
| IUPAC name | (2R)-3-(1-acetylpiperidin-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JOSJVRLACWWEMN-GFCCVEGCSA-N |
| SMILES | CC(=O)N1CCC(CC1)C[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)