Products 2162769-30-2

CAS 2162769-30-2 is the registry number for 4-(2-Oxa-6-azaspiro[3.3]heptan-6-yl)benzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)benzoic acid (CAS 2162769-30-2) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)benzoic acid. InChIKey: XPTBMTIIPCCOFP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO3
Molecular weight219.24 g/mol
IUPAC name4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)benzoic acid
InChIKeyXPTBMTIIPCCOFP-UHFFFAOYSA-N
SMILESC1C2(CN1C3=CC=C(C=C3)C(=O)O)COC2

Computed by PubChem (NCBI)