CAS 2163288-41-1 is the registry number for rel-Benzyl (1R,2S)-2-(aminomethyl)cyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-benzyl (1R,2S)-2-(aminomethyl)cyclopropane-1-carboxylate (CAS 2163288-41-1) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: trans-benzyl (1R,2S)-2-(aminomethyl)cyclopropane-1-carboxylate. InChIKey: IMZAMYJFNXCSMH-GHMZBOCLSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | trans-benzyl (1R,2S)-2-(aminomethyl)cyclopropane-1-carboxylate |
| InChIKey | IMZAMYJFNXCSMH-GHMZBOCLSA-N |
| SMILES | C1[C@@H]([C@@H]1C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)