Products 2165825-89-6
CAS 2165825-89-6 appears in our catalog under these names: (3R)-1-Oxo-2-azaspiro[4.5]decane-3-carboxylic acid, 95%, (3R)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 500mg.
(3R)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid (CAS 2165825-89-6) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: (3R)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: YATIBHHZINOUNN-SSDOTTSWSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (3R)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | YATIBHHZINOUNN-SSDOTTSWSA-N |
| SMILES | C1CCC2(CC1)C[C@@H](NC2=O)C(=O)O |
Computed by PubChem (NCBI)