Products 331951-85-0
CAS 331951-85-0 is the registry number for (3S)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3S)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid (CAS 331951-85-0) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: (3S)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid. InChIKey: YATIBHHZINOUNN-ZETCQYMHSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (3S)-1-oxo-2-azaspiro[4.5]decane-3-carboxylic acid |
| InChIKey | YATIBHHZINOUNN-ZETCQYMHSA-N |
| SMILES | C1CCC2(CC1)C[C@H](NC2=O)C(=O)O |
Computed by PubChem (NCBI)