Products 2165829-55-8
CAS 2165829-55-8 is the registry number for (4S)-1-[(tert-butoxy)carbonyl]-2-oxopiperidine-4-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidine-4-carboxylic acid (CAS 2165829-55-8) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: (4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidine-4-carboxylic acid. InChIKey: AFIJIYFXDXHROA-ZETCQYMHSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidine-4-carboxylic acid |
| InChIKey | AFIJIYFXDXHROA-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CC1=O)C(=O)O |
Computed by PubChem (NCBI)