Products 2165861-28-7
CAS 2165861-28-7 is the registry number for rac-2-[(1R,2R)-2-({[(tert-butoxy)carbonyl]amino}methyl)cyclopropyl]acetic acid, cis, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[(1R,2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclopropyl]acetic acid (CAS 2165861-28-7) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 2-[(1R,2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclopropyl]acetic acid. InChIKey: GQURQUMDZJQTFH-SFYZADRCSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-[(1R,2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclopropyl]acetic acid |
| InChIKey | GQURQUMDZJQTFH-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1C[C@@H]1CC(=O)O |
Computed by PubChem (NCBI)