Products 2165916-61-8

CAS 2165916-61-8 is the registry number for Phenylephrine Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(1R)-1-(3-hydroxyphenyl)-2-(methylamino)ethyl] acetate (CAS 2165916-61-8) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: [(1R)-1-(3-hydroxyphenyl)-2-(methylamino)ethyl] acetate. InChIKey: OAUWYIMUEDORPN-NSHDSACASA-N.

Identity
Molecular formulaC11H15NO3
Molecular weight209.24 g/mol
IUPAC name[(1R)-1-(3-hydroxyphenyl)-2-(methylamino)ethyl] acetate
InChIKeyOAUWYIMUEDORPN-NSHDSACASA-N
SMILESCC(=O)O[C@@H](CNC)C1=CC(=CC=C1)O

Computed by PubChem (NCBI)