Products 2166076-41-9
CAS 2166076-41-9 is the registry number for (2S,5S)–1–Methyl–5–phenylpyrrolidine–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1g, 500mg.
(2S,5S)-1-methyl-5-phenylpyrrolidine-2-carboxylic acid (CAS 2166076-41-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (2S,5S)-1-methyl-5-phenylpyrrolidine-2-carboxylic acid. InChIKey: PQKQBLZTEYWSMY-QWRGUYRKSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (2S,5S)-1-methyl-5-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | PQKQBLZTEYWSMY-QWRGUYRKSA-N |
| SMILES | CN1[C@@H](CC[C@H]1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)