Products 2166546-48-9
CAS 2166546-48-9 is the registry number for 1-[(4-BROMO-1-METHYL-1H-PYRAZOL-5-YL)METHYL]-3-AZETIDINOL, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-[(4-bromo-1-methylpyrazol-5-yl)methyl]azetidin-3-ol (CAS 2166546-48-9) is a chemical compound with the molecular formula C8H12BrN3O and a molecular weight of 246.10 g/mol. IUPAC name: 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]azetidin-3-ol. InChIKey: CKAZYKNKSIWLEX-UHFFFAOYSA-N.
| Molecular formula | C8H12BrN3O |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]azetidin-3-ol |
| InChIKey | CKAZYKNKSIWLEX-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)Br)CN2CC(C2)O |
Computed by PubChem (NCBI)