Products 2167097-23-4
CAS 2167097-23-4 is the registry number for 1-(6-(Trifluoromethyl)pyridin-3-yl)prop-2-en-1-one, 95% (stabilized with BHT). Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[6-(trifluoromethyl)-3-pyridinyl]prop-2-en-1-one (CAS 2167097-23-4) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 1-[6-(trifluoromethyl)-3-pyridinyl]prop-2-en-1-one. InChIKey: KLYDZFHCAXRTJI-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 1-[6-(trifluoromethyl)-3-pyridinyl]prop-2-en-1-one |
| InChIKey | KLYDZFHCAXRTJI-UHFFFAOYSA-N |
| SMILES | C=CC(=O)C1=CN=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)