Products 2167368-78-5
CAS 2167368-78-5 is the registry number for tert-Butyl 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate (CAS 2167368-78-5) is a chemical compound with the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. IUPAC name: tert-butyl 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: SLOFEUKRDZOMLC-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2S |
|---|---|
| Molecular weight | 242.34 g/mol |
| IUPAC name | tert-butyl 2-(1-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | SLOFEUKRDZOMLC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C(C)N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)