Products 2167543-98-6

CAS 2167543-98-6 is the registry number for 3-((Methylsulfonyl)methyl)-1,2,4-thiadiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(methylsulfonylmethyl)-1,2,4-thiadiazole-5-carboxylic acid (CAS 2167543-98-6) is a chemical compound with the molecular formula C5H6N2O4S2 and a molecular weight of 222.2 g/mol. IUPAC name: 3-(methylsulfonylmethyl)-1,2,4-thiadiazole-5-carboxylic acid. InChIKey: OPODRIXKBKRGCV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6N2O4S2
Molecular weight222.2 g/mol
IUPAC name3-(methylsulfonylmethyl)-1,2,4-thiadiazole-5-carboxylic acid
InChIKeyOPODRIXKBKRGCV-UHFFFAOYSA-N
SMILESCS(=O)(=O)CC1=NSC(=N1)C(=O)O

Computed by PubChem (NCBI)