CAS 89502-19-2 is the registry number for Methyl 4-sulfamoyl-1,2-thiazole-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-sulfamoyl-1,2-thiazole-3-carboxylate (CAS 89502-19-2) is a chemical compound with the molecular formula C5H6N2O4S2 and a molecular weight of 222.2 g/mol. IUPAC name: methyl 4-sulfamoyl-1,2-thiazole-3-carboxylate. InChIKey: XAZZWMNUPVCYAJ-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O4S2 |
|---|---|
| Molecular weight | 222.2 g/mol |
| IUPAC name | methyl 4-sulfamoyl-1,2-thiazole-3-carboxylate |
| InChIKey | XAZZWMNUPVCYAJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NSC=C1S(=O)(=O)N |
Computed by PubChem (NCBI)