CAS 960324-88-3 is the registry number for 2-METHANESULFONAMIDO-1,3-THIAZOLE-5-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-(methanesulfonamido)-1,3-thiazole-5-carboxylic acid (CAS 960324-88-3) is a chemical compound with the molecular formula C5H6N2O4S2 and a molecular weight of 222.2 g/mol. IUPAC name: 2-(methanesulfonamido)-1,3-thiazole-5-carboxylic acid. InChIKey: GUPKFAAOHDTJRK-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O4S2 |
|---|---|
| Molecular weight | 222.2 g/mol |
| IUPAC name | 2-(methanesulfonamido)-1,3-thiazole-5-carboxylic acid |
| InChIKey | GUPKFAAOHDTJRK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=NC=C(S1)C(=O)O |
Computed by PubChem (NCBI)