CAS 89502-04-5 is the registry number for Methyl 5-sulfamoylthiazole-4-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 5-sulfamoyl-1,3-thiazole-4-carboxylate (CAS 89502-04-5) is a chemical compound with the molecular formula C5H6N2O4S2 and a molecular weight of 222.2 g/mol. IUPAC name: methyl 5-sulfamoyl-1,3-thiazole-4-carboxylate. InChIKey: BPLOHXUVMDRKPV-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O4S2 |
|---|---|
| Molecular weight | 222.2 g/mol |
| IUPAC name | methyl 5-sulfamoyl-1,3-thiazole-4-carboxylate |
| InChIKey | BPLOHXUVMDRKPV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=N1)S(=O)(=O)N |
Computed by PubChem (NCBI)