Products 2167586-67-4
CAS 2167586-67-4 is the registry number for 8-Bromo-4,4-dimethyl-3,4-dihydroisoquinolin-1(2H)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one (CAS 2167586-67-4) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one. InChIKey: WSICFDXBJWLZSH-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 8-bromo-4,4-dimethyl-2,3-dihydroisoquinolin-1-one |
| InChIKey | WSICFDXBJWLZSH-UHFFFAOYSA-N |
| SMILES | CC1(CNC(=O)C2=C1C=CC=C2Br)C |
Computed by PubChem (NCBI)