CAS 2167618-39-3 is the registry number for tert-Butyl 6,6,8-trioxo-6λ-thia-2-azaspiro(3.4)octane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 6,6,8-trioxo-6lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 2167618-39-3) is a chemical compound with the molecular formula C11H17NO5S and a molecular weight of 275.32 g/mol. IUPAC name: tert-butyl 6,6,8-trioxo-6lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: FYMAVDZOVQXUAW-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | tert-butyl 6,6,8-trioxo-6lambda6-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | FYMAVDZOVQXUAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CS(=O)(=O)CC2=O |
Computed by PubChem (NCBI)