Products 2167942-61-0

CAS 2167942-61-0 is the registry number for 3-Nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (CAS 2167942-61-0) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 3-nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid. InChIKey: MXFGXFNIJUMIOB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO4
Molecular weight221.21 g/mol
IUPAC name3-nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid
InChIKeyMXFGXFNIJUMIOB-UHFFFAOYSA-N
SMILESC1CCC2=CC(=C(C=C2C1)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)