CAS 2167942-61-0 is the registry number for 3-Nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (CAS 2167942-61-0) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 3-nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid. InChIKey: MXFGXFNIJUMIOB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 3-nitro-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | MXFGXFNIJUMIOB-UHFFFAOYSA-N |
| SMILES | C1CCC2=CC(=C(C=C2C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)