Products 2169365-68-6
CAS 2169365-68-6 is the registry number for 2-[3-(2-methoxy-2-oxo-ethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-[3-(2-methoxy-2-oxoethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid (CAS 2169365-68-6) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: 2-[3-(2-methoxy-2-oxoethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid. InChIKey: BIZLUHJZNJYMBK-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 2-[3-(2-methoxy-2-oxoethyl)-1-bicyclo[1.1.1]pentanyl]acetic acid |
| InChIKey | BIZLUHJZNJYMBK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC12CC(C1)(C2)CC(=O)O |
Computed by PubChem (NCBI)