Products 2169481-19-8
CAS 2169481-19-8 is the registry number for 2-Chloro-3-fluoroquinoline-4-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 50mg.
2-chloro-3-fluoroquinoline-4-carboxylic acid (CAS 2169481-19-8) is a chemical compound with the molecular formula C10H5ClFNO2 and a molecular weight of 225.60 g/mol. IUPAC name: 2-chloro-3-fluoroquinoline-4-carboxylic acid. InChIKey: UGTPWGUUGPYWNN-UHFFFAOYSA-N.
| Molecular formula | C10H5ClFNO2 |
|---|---|
| Molecular weight | 225.60 g/mol |
| IUPAC name | 2-chloro-3-fluoroquinoline-4-carboxylic acid |
| InChIKey | UGTPWGUUGPYWNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=N2)Cl)F)C(=O)O |
Computed by PubChem (NCBI)