Products 216959-99-8
CAS 216959-99-8 is the registry number for 4-(2-(tert-Butoxycarbonyl)hydrazine-1-carbonyl)benzoic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
4-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]benzoic acid (CAS 216959-99-8) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]benzoic acid. InChIKey: ABMBQKGZMLVFCE-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]benzoic acid |
| InChIKey | ABMBQKGZMLVFCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)