CAS 216976-08-8 is the registry number for 3-Amino-4H-benzo[4,5]thiazolo[3,2-a]pyrimidin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-aminopyrimido[2,1-b][1,3]benzothiazol-4-one (CAS 216976-08-8) is a chemical compound with the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. IUPAC name: 3-aminopyrimido[2,1-b][1,3]benzothiazol-4-one. InChIKey: BMKFTNHMJHRKKI-UHFFFAOYSA-N.
| Molecular formula | C10H7N3OS |
|---|---|
| Molecular weight | 217.25 g/mol |
| IUPAC name | 3-aminopyrimido[2,1-b][1,3]benzothiazol-4-one |
| InChIKey | BMKFTNHMJHRKKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N3C(=O)C(=CN=C3S2)N |
Computed by PubChem (NCBI)