CAS 70057-85-1 appears in our catalog under these names: 5-(Benzofuran-2-yl)-1,3,4-thiadiazol-2-amine, 97%, 5-(1-Benzofuran-2-yl)-1,3,4-thiadiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-(1-benzofuran-2-yl)-1,3,4-thiadiazol-2-amine (CAS 70057-85-1) is a chemical compound with the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. IUPAC name: 5-(1-benzofuran-2-yl)-1,3,4-thiadiazol-2-amine. InChIKey: DWSXZOOSYNFWAV-UHFFFAOYSA-N.
| Molecular formula | C10H7N3OS |
|---|---|
| Molecular weight | 217.25 g/mol |
| IUPAC name | 5-(1-benzofuran-2-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | DWSXZOOSYNFWAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)