CAS 379725-80-1 appears in our catalog under these names: 5-(1H-Indol-3-yl)-[1,3,4]oxadiazole-2-thiol, 95%, 5-(1H-Indol-3-yl)-1,3,4-oxadiazole-2-thiol, 95%, 5-(1H-Indol-3-yl)-1,3,4-oxadiazole-2-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g.
5-(1H-indol-3-yl)-3H-1,3,4-oxadiazole-2-thione (CAS 379725-80-1) is a chemical compound with the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. IUPAC name: 5-(1H-indol-3-yl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: UVHFDWVKCUDWIL-UHFFFAOYSA-N.
| Molecular formula | C10H7N3OS |
|---|---|
| Molecular weight | 217.25 g/mol |
| IUPAC name | 5-(1H-indol-3-yl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | UVHFDWVKCUDWIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NNC(=S)O3 |
Computed by PubChem (NCBI)