Products 85678-84-8
CAS 85678-84-8 is the registry number for 9-Methyl-5H-pyrido[3,2-e]thiazolo[3,2-a]pyrimidin-5-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6,10,12-pentaen-8-one (CAS 85678-84-8) is a chemical compound with the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. IUPAC name: 3-methyl-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6,10,12-pentaen-8-one. InChIKey: LGZYRLUJRMFDNL-UHFFFAOYSA-N.
| Molecular formula | C10H7N3OS |
|---|---|
| Molecular weight | 217.25 g/mol |
| IUPAC name | 3-methyl-5-thia-2,7,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,6,10,12-pentaen-8-one |
| InChIKey | LGZYRLUJRMFDNL-UHFFFAOYSA-N |
| SMILES | CC1=CSC2=NC(=O)C3=C(N12)N=CC=C3 |
Computed by PubChem (NCBI)