Products 217197-03-0
CAS 217197-03-0 is the registry number for 2,5,5-Trimethyl-2-(2-methyl-5-nitrophenyl)-1,3-dioxane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,5,5-trimethyl-2-(2-methyl-5-nitrophenyl)-1,3-dioxane (CAS 217197-03-0) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 2,5,5-trimethyl-2-(2-methyl-5-nitrophenyl)-1,3-dioxane. InChIKey: CMCSWLBQDAOPHE-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 2,5,5-trimethyl-2-(2-methyl-5-nitrophenyl)-1,3-dioxane |
| InChIKey | CMCSWLBQDAOPHE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C2(OCC(CO2)(C)C)C |
Computed by PubChem (NCBI)