Products 2172550-10-4
CAS 2172550-10-4 is the registry number for 3-(3-Hydroxyoxetan-3-yl)piperidine-3-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
3-(3-hydroxyoxetan-3-yl)piperidine-3-carboxylic acid (CAS 2172550-10-4) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: 3-(3-hydroxyoxetan-3-yl)piperidine-3-carboxylic acid. InChIKey: QLFRSPFVZTUQTE-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-(3-hydroxyoxetan-3-yl)piperidine-3-carboxylic acid |
| InChIKey | QLFRSPFVZTUQTE-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)(C(=O)O)C2(COC2)O |
Computed by PubChem (NCBI)