CAS 21735-63-7 appears in our catalog under these names: 3-Phenyl-3-(2,2,2-trifluoro-acetylamino)-propionic acid, 97%, 3–Phenyl–3–(2,2,2–trifluoroacetamido)propanoic Acid, 3-Phenyl-3-(2,2,2-trifluoro-acetylamino)-propionic acid, 3-Phenyl-3-(2,2,2-trifluoroacetamido)propanoic acid 98%, 3-Phenyl-3-(2,2,2-trifluoroacetamido)propanoic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
3-phenyl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid (CAS 21735-63-7) is a chemical compound with the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. IUPAC name: 3-phenyl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid. InChIKey: SFOGCHRKQFVQON-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO3 |
|---|---|
| Molecular weight | 261.20 g/mol |
| IUPAC name | 3-phenyl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| InChIKey | SFOGCHRKQFVQON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)