CAS 57529-46-1 is the registry number for Ethyl 3-((2,2,2-trifluoroacetyl)amino)benzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Ethyl 3-[(2,2,2-trifluoroacetyl)amino]benzoate (CAS 57529-46-1) is a chemical compound with the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. IUPAC name: ethyl 3-[(2,2,2-trifluoroacetyl)amino]benzoate. InChIKey: XKZMSPMXSSFNRF-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO3 |
|---|---|
| Molecular weight | 261.20 g/mol |
| IUPAC name | ethyl 3-[(2,2,2-trifluoroacetyl)amino]benzoate |
| InChIKey | XKZMSPMXSSFNRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)