CAS 350-09-4 is the registry number for N-Trifluoroacetyl-l-phenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (CAS 350-09-4) is a chemical compound with the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. IUPAC name: (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid. InChIKey: WVHMOENDFIKQBZ-QMMMGPOBSA-N.
| Molecular formula | C11H10F3NO3 |
|---|---|
| Molecular weight | 261.20 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| InChIKey | WVHMOENDFIKQBZ-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)