CAS 2728-61-2 is the registry number for 3-Phenyl-2-(2,2,2-trifluoroacetamido)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (CAS 2728-61-2) is a chemical compound with the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. IUPAC name: 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid. InChIKey: WVHMOENDFIKQBZ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO3 |
|---|---|
| Molecular weight | 261.20 g/mol |
| IUPAC name | 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| InChIKey | WVHMOENDFIKQBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)